| Cas No.: | 1163719-91-2 |
| Chemical Name: | 1-(3-(tert-butyl)-1-phenyl-1H-pyrazol-5-yl)-3-(2-(methylthio)-4-((3-oxo-3,4-dihydropyrido[2,3-b]pyrazin-8-yl)oxy)phenyl)urea |
| Synonyms: | CCT 241161 |
| SMILES: | O=C1NC2N=CC=C(OC3C=CC(NC(NC4N(C5C=CC=CC=5)N=C(C(C)(C)C)C=4)=O)=C(SC)C=3)C=2N=C1 |
| Formula: | C28H27N7O3S |
| M.Wt: | 541.62 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CCT241161 is a potent pan-RAF inhibitor with IC50 of 30, 15 and 6 nM for BRAF, V600E-BRAF and C-RAF, also potently inhibits SRC and LCK (IC50=10 and 3 nM, respectively). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
