| Cas No.: | 269390-77-4 |
| Chemical Name: | Benzamide, 2-[(4-pyridinylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]- |
| Synonyms: | Benzamide, 2-[(4-pyridinylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]-;AAL-993;2,2'-((2-AMINOETHYL)AZANEDIYL)DIETHANOL;2-[(4-Pyridinylmethyl)amino]-N-[3-(trifluoromethyl)phenyl]benzami de;ZK-260255;AAL 993 |
| SMILES: | N1C=CC(CNC2C=CC=CC=2C(NC2C=CC=C(C(F)(F)F)C=2)=O)=CC=1 |
| Formula: | C20H16F3N3O |
| M.Wt: | 371.355754852295 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AAL993 (ZK260253) is a potent, orally active VEGFR inhibitor with IC50 of 130, 23 and 18 nM for VEGFR-1, 2 and 3, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
