| Cas No.: | 9004-99-3 |
| Chemical Name: | Polyoxyethylene stearate |
| Synonyms: | polyoxyethylene 8 stearate;Polyethylene glycol monostearate;MYRJ(TM) 53;MYRJ(TM) 59;MYRJ 58;MYRJ 59;MYRJ(R) 53;MYRJ(TM) 45;MYRJ 45;PEG 200 STEARATE;Polyoxyethylene stearate;PEG1000monostearate;PEG1540monostearate;PEG300monostearate;PEG4000monostearate;PEG400monostearate;PEG600monostearate;POES;Poly(oxy-1,2-ethanediyl), .α.-hydro-.ω.-hydroxy-, octadecanoate;Polyethylene Glycol Monostearate (10E.O.);Polyethylene Glycol Monostearate (25E.O.);Polyethylene Glycol Monostearate (55E.O.);POLYETHYLENE GLYCOL MONOSTEARATE N-4 (PALMITATE AND STEARATE MIXTURE);Polyethylene Glycol Monostearate(45E.O.);n≈10;n≈100;n≈25;PEG-100 stearate;PEG-32 stearate;PEG-6 stearate;PEG-8 stearate;PEG-75 stearate;Myrj 52;PEG monostearate;ENaC alpha Antibody;2-Hydroxyethyl stearate;Glycol stearate;2-Hydroxyethyl octadecanoate;Ethylene glycol monostearate;Cremophor A;Cerasynt M;Clearate G;Cerasynt MN;Cithrol PS;Polyoxyl 40 stearate;Polystate;Lactine;Myrj;Cithrol 10MS;Cerasynt 660;Polystate B;Prodhybase P;Akyporox S 100;PEG stearate;Soromin-SG;Lamacit CA;Emerest 2640;Stearoks 6;Stearoxa-6;Stearox 6;Nikkol MYS;Pegosperse S 9;Glycol monostearate;Emanon 3113;Stenol 8;Emcol H 35-A;Arosurf 1855E40;Polyoxyl(40)Stearate |
| SMILES: | O(C([H])([H])C([H])([H])O[H])C(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])=O |
| Formula: | C20H40O3 |
| M.Wt: | 328.5298 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A non-ionic emulsifying agent that can modulate multidrug resistance and enhances antitumor activity of vinblastine sulfate by modulating substrate-stimulated P-gp ATPase activity; inhibits P-gp mediated efflux in a concentration-dependent manner in Caco-2 cells, also shows potential inhibitory activitites agasint CYP2C9 and CYP2C19. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
