| Cas No.: | 101043-37-2 |
| Chemical Name: | Cyclo[2,3-didehydro-N-methylalanyl-D-alanyl-L-leucyl-(3S)-3-methyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyl-4,6-decadienoyl-D-γ-glutamyl] |
| Synonyms: | Cyanoginosin-LR;MC-LR |
| SMILES: | O=C1[C@@H](C)[C@]([H])(/C=C/C(/C)=C/[C@H](C)[C@H](CC2C=CC=CC=2)OC)NC([C@H](CCCNC(N)=N)NC([C@@H](C)[C@H](C(O)=O)NC([C@H](CC(C)C)NC([C@@H](C)NC(C(=C)N(C)C(CC[C@H](C(O)=O)N1)=O)=O)=O)=O)=O)=O |
| Formula: | C49H74N10O12 |
| M.Wt: | 995.1716 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective inhibitor of protein phosphatase 2A (PP2A) with IC50 of 0.04 nM; completely inhibits PP2A without affecting PP1 when used at a concentration of 0.5 nM, at least 10 times more potent as serine/threonine PP inhibitors than okadaic acid; PP1 IC50 is about 1.7 nM; shows cytotoxic activity against pancreatic cancer cells; also induces MMP-13 expression, promotes colorectal cancer invasion and migration. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
