| Cas No.: | 118-08-1 |
| Chemical Name: | 1(3H)-Isobenzofuranone, 6,7-dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-, (3S)- |
| Synonyms: | (-)-β-Hydrastine;(1R,9S)-β-Hydrastine |
| SMILES: | COC1C=CC2[C@@H]([C@@H]3N(C)CCC4=CC5OCOC=5C=C34)OC(=O)C=2C=1OC |
| Formula: | C21H21NO6 |
| M.Wt: | 383.3945 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An alkaloid of Hydrastis canadensis used in many dietary supplements intended to enhance the immune system; inhibits PAK4 kinase activity, suppresses the proliferation and invasion of human lung adenocarcinoma cells, inhibits expression of cyclin D1/D3 and CDK2/4/6, leading to cell cycle arrest at the G1 phase; also promotes the early apoptosis of lung adenocarcinoma cells through the mitochondrial apoptosis pathway. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
