| Cas No.: | 1173111-67-5 |
| Chemical Name: | Glycine, trans-4-[[2-(aminocarbonyl)-5-[4,5,6,7-tetrahydro-6,6-dimethyl-4-oxo-3-(trifluoromethyl)-1H-indazol-1-yl]phenyl]amino]cyclohexyl ester, methanesulfonate (1:1) |
| Synonyms: | SNX-5422 Mesylate;PF04929113 Mesylate;SNX5422 Mesylate |
| SMILES: | CS(=O)(O)=O.O=C1C2C(=NN(C3C=C(NC4CCC(OC(=O)CN)CC4)C(C(=O)N)=CC=3)C=2CC(C)(C)C1)C(F)(F)F |
| Formula: | C26H34F3N5O7S |
| M.Wt: | 617.6377 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | The prodrug of PF-04928473 (SNX-2112), a potent, orally bioavailable HSP90 inhibitor; inhibits several signaling pathways and induces apoptosis in CRPC LNCaP tumors in vivo.Blood CancerPhase 1 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
