| Cas No.: | 37321-09-8 |
| Chemical Name: | D-Streptamine, O-4-amino-4-deoxy-α-D-glucopyranosyl-(1→8)-O-(8R)-2-amino-2,3,7-trideoxy-7-(methylamino)-D-glycero-α-D-allo-octodialdo-1,5:8,4-dipyranosyl-(1→4)-2-deoxy- |
| Synonyms: | Nebramycin II |
| SMILES: | OCC1OC(OC2OC3CC(C(OC3C(O)C2NC)OC2C(N)CC(N)C(O)C2O)N)C(O)C(O)C1N |
| Formula: | C21H41N5O11 |
| M.Wt: | 539.5771 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An aminoglycoside antibiotic used in veterinary medicine. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
