| Cas No.: | 497836-10-9 |
| Chemical Name: | Benzoic acid, 4-[[5-bromo-4-[[2,4-dioxo-3-(2-oxo-2-phenylethyl)-5-thiazolidinylidene]methyl]-2-ethoxyphenoxy]methyl]- |
| Synonyms: | D-77 |
| SMILES: | O=C(O)C1=CC=C(COC2=CC(Br)=C(/C=C(SC(N3CC(C4=CC=CC=C4)=O)=O)/C3=O)C=C2OCC)C=C1 |
| Formula: | C28H22BrNO7S |
| M.Wt: | 596.4458 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent inhibitor of HIV-1 integrase-LEDGF/p75 interaction; binds to IN and IN(T125A) with Kd of 5.81 and 15.2 uM; affects the HIV-1 IN nuclear distribution thus exhibiting antiretroviral activity.HIV InfectionPreclinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
