| Cas No.: | 53868-26-1 |
| Chemical Name: | 4-Quinolinemethanol, 6,8-dichloro-α-2-piperidinyl-2-tricyclo[3.3.1.13,7]dec-1-yl-, hydrochloride (1:1) |
| Synonyms: | NSC305787 hydrochloride |
| SMILES: | OC(C1C2C(=C(C=C(C=2)Cl)Cl)N=C(C23CC4CC(CC(C4)C2)C3)C=1)C1CCCCN1.[H]Cl |
| Formula: | C25H31Cl3N2O |
| M.Wt: | 481.8854 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A small molecule inhibitor of Ezrin with Kd of 5.85 uM; inhibits ezrin phosphorylation, ezrin-actin interaction and ezrin-mediated motility of osteosarcoma (OS) cells in culture; inhibits lung metastasis of ezrin-sensitive cells in mice; also inhibits SHIP-1 and SHIP-2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
