| Cas No.: | 1017606-66-4 |
| Chemical Name: | Thieno[3,2-d]pyrimidin-4-amine, N-[(1S)-2-[4-[(3,4-dichlorophenyl)sulfonyl]-1-piperazinyl]-1-methylethyl]-7-methyl- |
| SMILES: | ClC1C=CC(S(=O)(N2CCN(CC(C)NC3C4SC=C(C)C=4N=CN=3)CC2)=O)=CC=1Cl |
| Formula: | C20H23Cl2N5O2S2 |
| M.Wt: | 500.4649 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective LPA2 (EDG4) antagonist with IC50 of 17 nM; inhibits the phosphorylation of Erk induced by LPA in a concentration dependent manner; inhibits HCT-116 colon cancer cell proliferation caused by LPA in a doses dependent manner. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
