| Cas No.: | 1805787-93-2 |
| Chemical Name: | 2-Propenamide, N-[3-[[[5-chloro-2-[[2-methoxy-4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]amino]methyl]phenyl]- |
| SMILES: | O=C(C=C)NC1=CC(CNC2=NC(NC3=C(OC)C=C(N4CCN(C)CC4)C=C3)=NC=C2Cl)=CC=C1 |
| Formula: | C26H30ClN7O2 |
| M.Wt: | 508.0151 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | JAK3-IN-1 is a potent and selective JAK3 inhibitor with IC50 of 4.8 nM; displays >150 fold selectivity versus JAK1 and JAK2; exhibits decent pharmacokinetic properties and is suitable for use in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
