| Cas No.: | 1332708-14-1 |
| Chemical Name: | 5-Pyrimidinecarboxamide, 4-[(2-methylpropyl)amino]-N-(phenylmethyl)-2-[4-[(tetrahydro-2H-pyran-3-yl)methyl]-1-piperazinyl]- |
| SMILES: | CC(CNC1=NC(N2CCN(CC3CCCOC3)CC2)=NC=C1C(NCC1C=CC=CC=1)=O)C |
| Formula: | C26H38N6O2 |
| M.Wt: | 466.6189 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective agonist of the rat (EC50=97 nM) and human (EC50=23 nM) TRPA1 channel; elicitsTRPA1-mediated nocifensive behaviour in mouse. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
