| Cas No.: | 339539-92-3 |
| Chemical Name: | Anamorelin (Fumarate) |
| Synonyms: | Anamorelin (Fumarate);2-amino-N-[(2R)-1-[(3R)-3-benzyl-3-[dimethylamino(methyl)carbamoyl]piperidin-1-yl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide,(E)-but-2-enedioic acid;ONO 7643 FuMarate;ONO-7643 Fumarate;RC1291 Fumarate;RC-1291 Fumarate;AnaMorelin (FuMarate);ONO7643 FuMarate;ONO-7643 FuMarate;RC 1291 FuMarate;RC1291 FuMarate;RC-1291 FuMarate;Anamorelin (RC-1291) Fumarate |
| SMILES: | [H][C@](CC1=CNC2=CC=CC=C21)(NC(C(C)(C)N)=O)C(N3CCC[C@@](C(N(C)N(C)C)=O)(CC4=CC=CC=C4)C3)=O.O=C(O)/C=C/C(O)=O |
| Formula: | C35H46N6O7 |
| M.Wt: | 662.775748729706 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A non-peptide, centrally-penetrant and selective agonist of GHSR with appetite-enhancing and anabolic effects; orally bioactive.Growth Hormone DeficiencyPhase 3 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
