| Cas No.: | 1421372-66-8 |
| Chemical Name: | 1,2,4-Benzenetriamine, N1-[2-(dimethylamino)ethyl]-5-methoxy-N1-methyl-N4-[4-(1-methyl-1H-indol-3-yl)-2-pyrimidinyl]- |
| SMILES: | CN(CCN(C1=CC(OC)=C(NC2=NC=CC(C3=CN(C)C4=CC=CC=C34)=N2)C=C1N)C)C |
| Formula: | C25H31N7O |
| M.Wt: | 445.5599 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Patent WO 2013014448 A1. 2 - (2, 4, 5 - substituted -anilino) pyrimidine derivatives as egfr modulators useful for treating cancer . |
| Description: | Mutated EGFR-IN-1 is a useful intermediate for the inhibitors design for mutated EGFR, such as L858R EGFR, Exonl9 deletion activating mutant and T790M resistance mutant. |
| Target: | EGFRL858R EGFRExon 19 deletion/T790M EGFRT790M |
| References: | [1]. Patent WO 2013014448 A1. 2 - (2, 4, 5 - substituted -anilino) pyrimidine derivatives as egfr modulators useful for treating cancer. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
