| Cas No.: | 1640282-30-9 |
| Chemical Name: | 2,4-Pyrimidinediamine, N4-cyclopropyl-6-(2,3-dichlorophenyl)-, hydrochloride (1:1) |
| Synonyms: | TH588 hydrochloride |
| SMILES: | NC1=NC(C2=CC=CC(Cl)=C2Cl)=CC(NC3CC3)=N1.[H]Cl |
| Formula: | C13H13Cl3N4 |
| M.Wt: | 331.6281 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent and selective inhibitor of MTH1 protein with IC50 of 5 nM; shows no relevant inhibition for MTH2,NUDT5, NUDT12,NUDT14,NUDT16 and other proteinswith known nucleoside triphosphate pyrophosphatase activity; causees incorporation of oxidized dNTPs in cancer cells, leading to DNA damage, cytotoxicity and therapeutic responses in patient-derived mouse xenografts. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
