| Cas No.: | 1404-90-6 |
| Chemical Name: | Vancomycin |
| SMILES: | C12=CC(=CC=C1O)[C@@H]1C(N[C@H](C(N[C@H](C(O)=O)C3C2=C(C=C(C=3)O)O)=O)[C@@H](C2C=CC(OC3=CC4=CC(OC5=CC=C(C=C5Cl)[C@@H](O)[C@@H](NC([C@H](NC)CC(C)C)=O)C(=O)N[C@H](C(=O)N[C@]4(C(=O)N1)[H])CC(N)=O)=C3O[C@@H]1O[C@@H]([C@@H](O)[C@@H]([C@H]1O[C@]1(C[C@]([C@@H]([C@@H](O1)C)O)(C)N)[H])O)CO)=C(C=2)Cl)O)=O |
| Formula: | C66H75Cl2N9O24 |
| M.Wt: | 1449.254 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An antibiotic used to treat a number of bacterial infections that acts by inhibiting proper cell wall synthesis.Bacterial InfectionApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
