| Cas No.: | 113-98-4 |
| Chemical Name: | potassium (2S,5R,6R)-3,3-dimethyl-7-oxo-6-(2-phenylacetamido)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonyms: | Picibanil; Sapylin; OK 432; OK-432; OK432; Penicillin G Potassium Salt |
| SMILES: | [K+].O=C(N[C@@H]1C(=O)N2[C@H](C(S[C@]12[H])(C)C)C([O-])=O)CC1=CC=CC=C1 |
| Formula: | C16H17KN2O4S |
| M.Wt: | 372.4803 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An antibiotic used to treat a number of bacterial infections.Bacterial InfectionApproved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
