| Cas No.: | 1646-88-4 |
| Chemical Name: | Propanal, 2-methyl-2-(methylsulfonyl)-, O-[(methylamino)carbonyl]oxime |
| SMILES: | CNC(O/N=C/C(C)(S(C)(=O)=O)C)=O |
| Formula: | C7H14N2O4S |
| M.Wt: | 222.2621 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A carbamate insecticide that acts as a fast-acting cholinesterase inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
