| Cas No.: | 893449-38-2 |
| Chemical Name: | 5-5-Bromo-2-(2-bromophenyl)methoxyphenylmethylene-2-thioxo-4-thiazolidinone |
| Synonyms: | 4-Thiazolidinone,5-[[5-bromo-2-[(2-bromophenyl)methoxy]phenyl]methylene]-2-thioxo-;5-[[5-Bromo-2-[(2-bromophenyl)methoxy]phenyl]methylene]-2-thioxo-4-thiazolidinone;PRL-3 Inhibitor;PRL-3 INHIBITOR I;Phosphatase of regenerating liver-3, Inhibitor I;5-[[5-bromo-2-[(2-bromophenyl)methoxy]phenyl]methylene]-2-thioxo-4-thiazolidinone;5-[[5-Bromo-2-[(2-bromophenyl)methoxy]phenyl]methylene]-2-thioxo-4-thiazolidinone (ACI);PRL-3 inhibitor I |
| SMILES: | O=C1C(=CC2C(OCC3C(Br)=CC=CC=3)=CC=C(Br)C=2)SC(=S)N1 |
| Formula: | C17H11Br2NO2S2 |
| M.Wt: | 485.212740182877 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
