To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 90693-88-2 |
| Chemical Name: | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium |
| Synonyms: | L-Serine, (2R)-2,3-bis[[(9Z)-1-oxo-9-octadecenyl]oxy]propyl hydrogenphosphate (ester), monosodium salt;1,2-dioleoyl-sn-glycero-3-phospho-L-serine (sodium salt);18:1 PS (DOPS);1,2-di-(9Z-octadecenoyl)-sn-glycero-3-phospho-L-serine (sodium salt);18:1(9Z));DOPS;PS(18:1(9Z);L-Serine, (2R)-2,3-bis[[(9Z)-1-oxo-9-octadecenyl]oxy]propyl hydrogen phosphate (ester), monosodium salt (9CI);L-Serine, 2,3-bis[(1-oxo-9-octadecenyl)oxy]propyl hydrogen phosphate (ester), monosodium salt, [R-(Z,Z)]- (ZCI);1,2-Di-(9Z-octadecenoyl)-sn-glycero-3-phospho-L-serine;1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium salt;Coatsome MS 8181LS;1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium |
| SMILES: | [C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)(OC(=O)CCCCCCC/C=C\CCCCCCCC)COP(O)(=O)OC[C@H](N)C(=O)O.[Na] |
| Formula: | C42H78NNaO10P |
| M.Wt: | 811.032966136932 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |