| Cas No.: | 726196-75-4 |
| Chemical Name: | PS-13 precursor 19 |
| Synonyms: | Phenol, 4-[1-(4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)-1H-1,2,4-triazol-5-yl]- |
| SMILES: | COC1=CC=C(N2N=C(OCC(F)(F)F)N=C2C2=CC=C(O)C=C2)C=C1 |
| Formula: | C17H14F3N3O3 |
| M.Wt: | 365.31 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
