| Cas No.: | 3034673-92-9 |
| Chemical Name: | Pan-RAS-IN-2 |
| Synonyms: | 3034673-92-9;(1r,2R,3S)-N-((64S,4S,Z)-11-ethyl-12-(2-((S)-1-methoxyethyl)-5-(4-methylpiperazin-1-yl)pyridin-3-yl)-10,10-dimethyl-5,7-dioxo-11H-8-oxa-62,63-diaza-2(4,2)-thiazola-1(5,3)-indola-6(2,4)-bicyclo[3.1.1]heptanacycloundecaphane-4-yl)-2,3-dimethylcyclopropane-1-carboxamide;HY-158409;Pan-RAS-IN-2;CS-1054290 |
| SMILES: | S1C=C2C3C=CC4=C(C=3)C(=C(C3=CC(=CN=C3[C@@H](C)OC)N3CCN(C)CC3)N4CC)CC(C)(C)COC([C@@H]3C4CC(C4)N(C([C@@H](CC1=N2)NC(C1[C@@H](C)[C@H]1C)=O)=O)N3)=O |
| Formula: | C46H60N8O5S |
| M.Wt: | 837.08 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
