| Cas No.: | 1912357-12-0 |
| Chemical Name: | (R)-4-methyl-N-(3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl)-2-(pyrimidin-5-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide |
| Synonyms: | DDR1 inhibitor 6j |
| SMILES: | C1C2=C(C=CC(C(NC3=CC(C(F)(F)F)=CC(N4C=NC(C)=C4)=C3)=O)=C2)[C@H](C)CN1C1=CN=CN=C1 |
| Formula: | C26H23F3N6O |
| M.Wt: | 492.506 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
