| Cas No.: | 2244425-14-5 |
| Chemical Name: | 2-((3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)amino)-2-oxoethyl 2-(5-ethynyl-2-methyl-1H-indol-3-yl)acetate |
| Synonyms: | DKFZ633;DKFZ 633 |
| SMILES: | C(OCC(NC1=C(C)N(C2=CC=CC=C2)N=C1C)=O)(=O)CC1C2=C(NC=1C)C=CC(C#C)=C2 |
| Formula: | C26H24N4O3 |
| M.Wt: | 440.503 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DKFZ-633 (DKFZ633) is a selective inhibitor of Kallikrein-related peptidase 6 (KLK6) with IC50 of 0.25 uM, demonstrates good selectivity for KLK6 compared to other KLKs; DKFZ-633 is a useful chemical probe to pull down active endogenous KLK6. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
