| Cas No.: | 577-11-7 |
| Chemical Name: | sodium 1,4-bis((2-ethylhexyl)oxy)-1,4-dioxobutane-2-sulfonate |
| Synonyms: | Docusate, Docusate hydrogen, Docusate calcium, Docusate sodium, Docusate potassium, Docusate aluminum, Doc-Q-Lace, Doc Q Lace, DocQLace, Colace |
| SMILES: | O=C(OCC(CC)CCCC)C(S(=O)([O-])=O)CC(OCC(CC)CCCC)=O.[Na+] |
| Formula: | C20H37NaO7S |
| M.Wt: | 444.5588 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
