| Cas No.: | 1264754-13-3 |
| Chemical Name: | PROTAC ERRα ligand 1 |
| Synonyms: | E3 ligase Ligand 5;E3 ligase Ligand 5;PROTAC ERRα ligand 1;PROTAC ERRα ligand 1;4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile;4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile;PROTAC ERRα ligand 1,inhibit,PROTAC ERRα ligand-1,Inhibitor,PROTAC ERRα ligand1,Estrogen Receptor/ERR;PROTAC ERRα ligand 1,inhibit,PROTAC ERRα ligand-1,Inhibitor,PROTAC ERRα ligand1,Estrogen Receptor/ERR |
| SMILES: | C(#N)C1=CC=C(OC2=CC=C(/C=C3\SC(=O)NC\3=O)C=C2OC)C(C(F)(F)F)=C1 |
| Formula: | C19H11F3N2O4S |
| M.Wt: | 420.361853837967 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
