| Cas No.: | 16470-02-3 |
| Chemical Name: | 6-(3-Chloro-phenyl)-pteridine-2,4,7-triamine |
| Synonyms: | Epiblastin A; AUE; |
| SMILES: | NC1=NC(N)=C2N=C(C3=CC=CC(Cl)=C3)C(N)=NC2=N1 |
| Formula: | C12H10ClN7 |
| M.Wt: | 287.71 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Epiblastin A is a Casein Kinase 1 (CK1) inhibitor. Epiblastin A engages CK1 isoenzymes in cell lysate and induces efficient conversion of epiblast stem cells (EpiSCs) into embryonic stem cells (cESCs). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
