| Cas No.: | 54350-48-0 |
| SMILES: | O=C(OCC)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C=C(OC)C(C)=C1C |
| Formula: | C23H30O3 |
| M.Wt: | 354.48 |
| Purity: | >98% |
| Description: | Etretinate is an oral aromatic retinoid acid which is effective in psoriasis and other dermatological syndromes. It activates retinoid receptors, causing an induction of cell differentiation, inhibition of cell proliferation, and inhibition of tissue infiltration by inflammatory cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
