| Cas No.: | 59973-80-7 |
| Chemical Name: | (Z)-Sulindac Sulfone |
| Synonyms: | 1H-Indene-3-aceticacid, 5-fluoro-2-methyl-1-[[4-(methylsulfonyl)phenyl]methylene]-, (1Z)-;Sulindac Sulfone;EXISULIND;2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetic acid |
| SMILES: | CC/1=C(CC(=O)O)C2=C(C=CC(=C2)F)\C1=C/C3=CC=C(C=C3)S(=O)(=O)C |
| Formula: | C20H17O4FS |
| M.Wt: | 372.40998 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
