| Cas No.: | 2098663-92-2 |
| Chemical Name: | (4S,7S,10S)-10-((S)-4-amino-2-(2-(4-(tert-butyl)phenyl)-4-methylpyrimidine-5-carboxamido)-N-methylbutanamido)-16,26-bis(2-aminoethoxy)-N-(cyanomethyl)-7-methyl-6,9-dioxo-5,8-diaza-1,2(1,3)-dibenzenacyclodecaphane-4-carboxamide |
| Synonyms: | G0775,G-0775,G 0775 |
| SMILES: | NCCOC1=C(C2=CC(C[C@@H](C(NCC#N)=O)NC3=O)=CC=C2OCCN)C=C([C@@H](C(N[C@H]3C)=O)N(C([C@@H](NC(C4=C(C)N=C(C5=CC=C(C(C)(C)C)C=C5)N=C4)=O)CCN)=O)C)C=C1 |
| Formula: | C47H59N11O7 |
| M.Wt: | 890.059 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | G0775 is more effective against gram-negative bacteria than other agents. Testing showed that G0775 was effective in killing both Escherichia coli and Klebsiella pneumonia in cells in a petri dish and in mouse models. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
