| Cas No.: | 421581-52-4 |
| Chemical Name: | 2,2'-disulfanediylbis(N-(2-(1H-indol-3-yl)ethyl)ethan-1-amine) |
| Synonyms: | AG1;AG-1,AG 1 |
| SMILES: | S(CCNCCC1C2=C(NC=1)C=CC=C2)SCCNCCC1C2=C(NC=1)C=CC=C2 |
| Formula: | C24H30N4S2 |
| M.Wt: | 438.652 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | 1. Hwang S, et al. Nat Commun. 2018 Oct 2;9(1):4045. |
| Description: | G6PD activator AG1 is a glucose-6-phosphate dehydrogenase (G6PD) activator with an EC50 of 3 µΜ, extracted from patent WO2019023264A1, compound AG1[1]. |
| Target: | IC50: 3 µΜ (G6PD)[1] |
| References: | [1]. https://patents.google.com/patent/WO2019023264A1/en?oq=WO2019023264A1 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
