| Cas No.: | |
| Chemical Name: | HS-10 |
| Synonyms: | HS10;HS 10 |
| SMILES: | CC1=NN(C2=CC(N[C@H]3CC[C@H](O)CC3)=C(C(N)=O)C=C2)C2=C1C(=O)CC(C)(C)C2 |
| Formula: | C23H30O3N4 |
| M.Wt: | 410.52 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HS-10 is a novel Hsp90 inhibitor increases the Tm of Hsp90 by 10.5°C. HS-10 alone also induced degradation of HER2 and Akt, as well as increased Hsp70 protein levels as expected, due to the negative regulatory role that Hsp90 has on heat shock transcription factor 1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
