| Cas No.: | |
| Chemical Name: | L-threonyl-L-cysteinyl-L-tryptophyl-L-lysyl-L-histidyl-L-arginyl-L-lysine |
| Synonyms: | HT-105;HT 105 |
| SMILES: | C(O)(=O)[C@@H](CCCCN)NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H](CC1N=CNC=1)NC(=O)[C@@H](CCCCN)NC(=O)[C@@H](CC1C2C(=CC=CC=2)NC=1)NC(=O)[C@@H](CS)NC(=O)[C@@H]([C@@H](O)C)N |
| Formula: | C42H67N15O9S |
| M.Wt: | 958.154 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DB550 (DB-550, TCWKHRK) is a potent, peptidomimetic of calcium-inducing domain (CID) that disrupts the CD95-PLCγ1 interaction, abrogates the CD95-mediated Ca2+ response in mouse PBLs with IC50 of 38 nM; exerted a potent cytotoxic effect against a large panel of tumor cell lines, unlike DB550, HT105 possesses off-target effects responsible for triggering a cell-death program in tumor cells. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
