| Cas No.: | 861891-50-1 |
| Chemical Name: | IM-54 |
| Synonyms: | 1-methyl-3-(1-methylindol-3-yl)-4-(pentylamino)pyrrole-2,5-dione;2-(1H-Indol-3-yl)-3-pentylamino-maleimide;AGN-PC-015JTY;CHEMBL365337;CTK8E7879;MolPort-009-019-559;IN1208;IM-54;NECROSIS INHIBITOR, IM-54;1-Methyl-3-(1-methyl-1H-indol-3-yl)-4-(pentylamino)-1H-pyrrole-2,5-dione;1-Methyl-3-(1-methyl-1H-indol-3-yl)-4-(pentylamino)-1H-pyrrole-2,5-dione (ACI);IM 54;IM 54 (necrosis inhibitor) |
| SMILES: | O=C1N(C)C(=O)C(C2C3C(=CC=CC=3)N(C)C=2)=C1NCCCCC |
| Formula: | C19H23N3O2 |
| M.Wt: | 325.404824495316 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
