| Cas No.: | 1690176-75-0 |
| Chemical Name: | PAR-2-IN-1 |
| Synonyms: | Methyl 8-(tert-butyl)-6-chloroimidazo[1,2-b]pyridazine-2-carboxylate;AK543900;methyl 8-tert-butyl-6-chloroimidazo[1,2-b]pyridazine-2-carboxylate;PAR-2-IN-1 |
| SMILES: | ClC1C([H])=C(C2=NC(C(=O)OC([H])([H])[H])=C([H])N2N=1)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] |
| Formula: | C12H14ClN3O2 |
| M.Wt: | 267.7115 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
