| Cas No.: | 245342-14-7 |
| SMILES: | C1(NS(C2C=CC(NC(NC3C=CC=CC=3)=S)=CC=2)(=O)=O)C=CC=CC=1 |
| Formula: | C19H17N3O2S2 |
| M.Wt: | 383.49 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LED209 is a potent QseC inhibitor that blocks both norepinephrine- and epinephrine-triggered QseC-dependent virulence gene expression at 5 pM in vitro. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
