| Cas No.: | 1627696-53-0 |
| Chemical Name: | (3R)-3-(5-Fluoro-4-pyrimidinyl)-2,3-dihydro-3-methyl-6-(1H-pyrazol-4-yl)-1H-isoindol-1-one hydrate |
| Synonyms: | LY-3143921;LY 3143921 |
| SMILES: | C(=O)1C2=C(C=CC(C3=CNN=C3)=C2)[C@](C2C(F)=CN=CN=2)(C)N1.[H]O[H] |
| Formula: | C16H14FN5O2 |
| M.Wt: | 327.319 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
