| Cas No.: | 135662-07-6 |
| Synonyms: | Dnp-PLGMWSR;Dnp-Pro-Leu-Gly-Met-Trp-Ser-Arg-OH;Matrix Metalloproteinase-2/Matrix Metalloproteinase-9 Fluorogenic Substrate I;MMP-2/MMP-9 Fluorogenic Substrate I |
| SMILES: | O=C(N[C@@H](CO)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)[C@@H](NC([C@H](CCSC)NC(CNC([C@H](CC(C)C)NC([C@H]1N(C2=CC=C([N+]([O-])=O)C=C2[N+]([O-])=O)CCC1)=O)=O)=O)=O)CC3=CNC4=C3C=CC=C4 |
| Formula: | C44H61N13O13S |
| M.Wt: | 1012.1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Dnp-PLGMWSR is a fluorogenic substrate for matrix metalloproteinase-2 (MMP-2) and MMP-9.The activity of MMP-2 and MMP-9 can be quantified by measuring tryptophan fluorescence that is unquenched upon peptide hydrolysis that removes the N-terminal dinitrophenol (Dnp) group. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
