| Cas No.: | 1351169-31-7 |
| Chemical Name: | PROTAC AR Degrader-4 |
| SMILES: | O=C1CC[C@@]2(C)[C@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@@H]4OC(COCCOCCOCCNC([C@H](CC(C)C)NC([C@@H](O)[C@H](N)CC5=CC=CC=C5)=O)=O)=O)([H])C1 |
| Formula: | C43H67N3O9 |
| M.Wt: | 770.01 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
