| Cas No.: | 1784751-20-7 |
| Chemical Name: | Pyridine, 4-[2-(1-fluoro-2-naphthalenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]- |
| Synonyms: | PUN51207; PUN-51207; PUN 51207; CK1-IN-1; CK1-IN1; CK1-IN 1; |
| SMILES: | FC1=CC=C(C2=C(C3=CC=NC=C3)NC(C4=CC=C5C=CC=CC5=C4F)=N2)C=C1 |
| Formula: | C24H15F2N3 |
| M.Wt: | 383.4 |
| Purity: | >98% |
| Sotrage: | >3 years if stored properly |
| Description: | CK1-IN-1 is a casein kinase 1 (CK1) inhibitor extracted from patent WO2015119579A1, compound 1c, has IC50s of 15 nM, 16 nM, 73 nM for CK1δ, and CK1ε, p38σ MAPK, respectively[1]. |
| Target: | CKIδ:15 nM (IC50) CK1ϵ:16 nM (IC50) |
| References: | [1]. Filip LACO,et al. 2,4,5-tri-substituted azole-based casein kinase 1 inhibitors as inducers for cardiomyogenesis. WO2015119579A1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
