| Cas No.: | 59068-47-2 |
| Chemical Name: | Bz-Ile-Glu-Gly-Arg-pNA acetate salt |
| Synonyms: | bz-ile-glu-gly-arg-pna;Nα-Benzoyl-L-isoleucyl-L-glutamyl-glycyl-L-arginine-4-nitroanilide;(4S)-4-[[(2S,3S)-2-benzamido-3-methylpentanoyl]amino]-5-[[2-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES: | CC[C@@H]([C@H](NC(C1=CC=CC=C1)=O)C(N[C@H](C(NCC(N[C@H](C(NC2=CC=C([N+]([O-])=O)C=C2)=O)CCCNC(N)=N)=O)=O)CCC(O)=O)=O)C |
| Formula: | C32H43N9O9.HCl |
| M.Wt: | 734.19966 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
