| Cas No.: | 2073059-82-0 |
| Chemical Name: | SBI-993 |
| SMILES: | S1C(=NC(C2=CC=C(C=C2)OC)=C1)NC(=O)C1C=CC(NCC(=C)N2CCOCC2)=CC=1 |
| Formula: | C24H26N4O3S |
| M.Wt: | 450.553244113922 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SBI-993 is an analog of SBI-477 that shows improved potency and suitable pharmacokinetic properties for in vivo bioavailability |
| In Vitro: | SBI-993 is an analog of SBI-477 that shows improved potency and suitable pharmacokinetic properties for in vivo bioavailability; reduces Txnip and Arrdc4 expression to a degree similar to that seen with SBI-477 in human myotubes; reduces muscle and liver TAG levels, enhances insulin signaling, and improved glucose tolerance in mice fed a high-fat diet. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
