| Cas No.: | 211110-63-3 |
| Chemical Name: | Sobetirome |
| Synonyms: | Acetic acid, [4-[[4-hydroxy-3-(1-methylethyl)phenyl]methyl]-3,5-dimethylphenoxy]-;2-[4-[[4-hydroxy-3-(1-methylethyl)phenyl]methyl]-3,5-dimethylphenoxy]acetic acid;2-[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid;GC 1;QRX 431;Sobetirome;{4-[4-hydroxy-3-(propan-2-yl)benzyl]-3,5-dimethylphenoxy}acetic acid;acetic acid, 2-[4-[[4-hydroxy-3-(1-methylethyl)phenyl]methyl]-3,5-dimethylphenoxy]-;GC-1;QRX-431;2-[4-[[4-Hydroxy-3-(1-methylethyl)phenyl]methyl]-3,5-dimethylphenoxy]acetic acid;3,5-Dimethyl-4-(4′-hydroxy-3′-isopropylbenzyl)phenoxyacetic acid;GC 1 (pharmaceutical);[3,5-Dimethyl-4-(4-hydroxy-3-isopropylbenzyl)phenoxy]acetic acid;GC-1;Acetic acid,[4-[[4-hydroxy-3-(1-methylethyl)phenyl]methyl]-3,5-dimethylphenoxy]- |
| SMILES: | O=C(O)COC1=CC(C)=C(CC2=CC=C(O)C(C(C)C)=C2)C(C)=C1 |
| Formula: | C20H24O4 |
| M.Wt: | 328.40216 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Sobetirome(GC-1; QRX-431) is a member of a class of compounds known as selective thyromimetics. Sobetirome is thyroid hormone beta-receptor agonist. Sobetirome selectively binds to and activates TRbeta over TRalpha and this receptor selectivity led to the hypothesis that sobetirome would lower cholesterol through activation of liver TRbeta without stimulating cardiac function through TRalpha activation in the heart. The tissue selective thyromimetic properties of sobetirome have been demonstrated in numerous animal models, which led to its clinical development as a novel cholesterol-lowering agent. Treatment of hypercholestemia obesity, and thyroid proliferative disorders. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
