| Cas No.: | 950003-29-9 |
| Chemical Name: | N-{5-(diethylsulfamoyl)thiophen-2-ylmethyl}-4-phenylpiperazine-1-carboxamide |
| Synonyms: | T5996207;N-((5-(N,N-Diethylsulfamoyl)thiophen-2-yl)methyl)-4-phenylpiperazine-1-carboxamide;T5910047;Z231068704;N-{[5-(diethylsulfamoyl)thiophen-2-yl]methyl}-4-phenylpiperazine-1-carboxamide;N-{5-(diethylsulfamoyl)thiophen-2-ylmethyl}-4-phenylpiperazine-1-carboxamide |
| SMILES: | S(C1=CC=C(CNC(N2CCN(C3C=CC=CC=3)CC2)=O)S1)(N(CC)CC)(=O)=O |
| Formula: | C20H28N4O3S2 |
| M.Wt: | 436.59132194519 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | T5910047 (T-5910047) is a small molecule inhibitor of MyD88-dependent signaling pathways, disrupts MyD88 homodimeric formation; inhibits SEB-induced inhibition of cytokine production in PBMCs with IC50 of 2-10 uM, also inhibits SEA-induced pro-inflammatory cytokine production, shows no toxicity in primary cells up to 100 uM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
