| Cas No.: | 936091-15-5 |
| Chemical Name: | N-tert-butyl-3-[[5-methyl-2-[4-(morpholin-4-ylmethyl)anilino]pyrimidin-4-yl]amino]benzenesulfonamide |
| Synonyms: | 936091-15-5; SCHEMBL264717; RS0111; EX-8668; NCGC00345846-01; Benzenesulfonamide, N-(1,1-dimethylethyl)-3-[[5-methyl-2-[[4-(4-morpholinylmethyl)phenyl]amino]-4-pyrimidinyl]amino]- |
| SMILES: | C(S(NC(C)(C)C)(=O)=O)1=CC=CC(NC2C(C)=CN=C(NC3=CC=C(CN4CCOCC4)C=C3)N=2)=C1 |
| Formula: | C26H34N6O3S |
| M.Wt: | 510.6 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TG-46 is an inhibitor of JAK2, FLT3, RET, JAK3 with IC50 values of 6nM, 25nM, 17nM, 169nM respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
