| Cas No.: | 5915-41-3 |
| Chemical Name: | N2-(tert-Butyl)-6-chloro-N4-ethyl-1,3,5-triazine-2,4-diamine |
| Synonyms: | N2-(tert-Butyl)-6-chloro-N4-ethyl-1,3,5-triazine-2,4-diamine;2-tert-butylamino-4-chloro-6-ethylamino-1,3,5-triazine;Terbutylazine;Terbuthylazine;Terbuthylazine Solution;6-chloro-N-(1,1-dimethylethyl)-N’-ethyl-1,3,5-triazine-2,4-diamine;N2-tert-butyl-6-chloro-N4-ethyl-1,3,5-triazine-2,4-diamine;Tetinjin;2-tert-Butylamino-4-chloro-6-ethylamino-1,3,5-triazine;6-Chloro-N-(1,1-dimethylethyl)-N'-ethyl-1,3,5-triazine-2,4-diamine;Gardoprim;GS-13529;Primatol M |
| SMILES: | C(NC1N=C(NCC)N=C(Cl)N=1)(C)(C)C |
| Formula: | C9H16ClN5 |
| M.Wt: | 229.709839820862 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Terbuthylazine is an inhibitor of acetolactate syntase (ALS), is a selective herbicide. |
| References: | [1]. Cedergreen N, et al. Does the effect of herbicide pulse exposure on aquatic plants depend on Kow or mode of action? Aquat Toxicol. 2005 Feb 10;71(3):261-271. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
