| Cas No.: | 2438124-79-7 |
| Chemical Name: | ALV1 |
| Synonyms: | Benzenepropanamide, N-(3-chloro-4-methylphenyl)-3-[[1-(2,6-dioxo-3-piperidinyl)-2,5-dihydro-2,5-dioxo-1H-pyrrol-3-yl]amino]-;ALV1 |
| SMILES: | C1(CCC(NC2=CC=C(C)C(Cl)=C2)=O)=CC=CC(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)=C1 |
| Formula: | C25H23ClN4O5 |
| M.Wt: | 494.93 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
