| Cas No.: | 2412985-00-1 |
| Chemical Name: | aTAG 4531 |
| Synonyms: | CFT-4531 |
| SMILES: | O=C(C1=C(F)C=C(C2=CC3=C(NC4=CC=CC=C4)C(C(NC5CC5)=O)=CN=C3C=C2F)C=C1)NCCCCN6N=NC(COC7=CC=CC(C(N8C9C(NC(CC9)=O)=O)=O)=C7C8=O)=C6 |
| Formula: | C46H39F2N9O7 |
| M.Wt: | 867.85 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
