| Cas No.: | 384859-58-9 |
| Chemical Name: | BCH001 |
| Synonyms: | BCH001;2-[[3-ethoxycarbonyl-6-(trifluoromethoxy)quinolin-4-yl]amino]benzoic acid;2-((3-(Ethoxycarbonyl)-6-(trifluoromethoxy)quinolin-4-yl)amino)benzoicacid;2-((3-(Ethoxycarbonyl)-6-(trifluoromethoxy)quinolin-4-yl)amino)benzoic acid;2-{[3-(ethoxycarbonyl)-6-(trifluoromethoxy)quinolin-4-yl]amino}benzoic acid;HMS1807H10;s8977;STK677229;UNM000011039701;SR- |
| SMILES: | FC(OC1C([H])=C([H])C2C(C=1[H])=C(C(C(=O)OC([H])([H])C([H])([H])[H])=C([H])N=2)N([H])C1=C([H])C([H])=C([H])C([H])=C1C(=O)O[H])(F)F |
| Formula: | C20H15F3N2O5 |
| M.Wt: | 420.3387 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BCH001 is a specific PAPD5 inhibitor that restores telomerase activity and telomere length in dyskeratosis congenita (DC) patient induced pluripotent stem cells. PAPD5 is a noncanonical poly(A) polymerase with an unusual RNA-binding motif. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
