| Cas No.: | 2230836-55-0 |
| Chemical Name: | N-((R)-1-(3-amino-5-(trifluoromethyl)phenyl)ethyl)-7-methoxy-2-methyl-6-(((S)-tetrahydrofuran-3-yl)oxy)quinazolin-4-amine |
| Synonyms: | BI-3406; BI 3406; BI3406 |
| SMILES: | CC1=NC2=CC(=C(C=C2C(=N1)NC(C)C3=CC(=CC(=C3)N)C(F)(F)F)OC4CCOC4)OC |
| Formula: | C23H25F3N4O3 |
| M.Wt: | 462.46 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BI-3406(SOS1-IN-2) is a Son of Sevenless 1 (SOS1) inhibitor extracted from patent WO2018115380A1, compound I-6, and it has an IC50 of 6 nM[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
